C29H24N6O5S2 — CID 54546596
benzhydryl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(cyanomethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54546596) has the molecular formula C29H24N6O5S2 and a molecular weight of 600.68 g/mol. Its IUPAC name is benzhydryl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(cyanomethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(cyanomethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54546596 |
| Molecular Formula | C29H24N6O5S2 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | benzhydryl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(cyanomethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(=NOCC#N)c3csc(N)n3)[C@@H]2SC1 |
| InChI | InChI=1S/C29H24N6O5S2/c1-2-17-15-41-27-22(33-25(36)21(34-39-14-13-30)20-16-42-29(31)32-20)26(37)35(27)23(17)28(38)40-24(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h2-12,16,22,24,27H,1,14-15H2,(H2,31,32)(H,33,36)/t22?,27-/m0/s1 |
| InChIKey | ZGYIHJZVHVQPAT-ZUILJJEPSA-N |
| XLogP | 3.14 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|