C27H24ClN5O7S2 — CID 173434679
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-benzhydryloxy-2-oxoethoxy)iminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173434679) has the molecular formula C27H24ClN5O7S2 and a molecular weight of 630.10 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-benzhydryloxy-2-oxoethoxy)iminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-benzhydryloxy-2-oxoethoxy)iminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173434679 |
| Molecular Formula | C27H24ClN5O7S2 |
| Molecular Weight | 630.10 g/mol |
| Exact Mass | 629.08 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-benzhydryloxy-2-oxoethoxy)iminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | Nc1nc(C(=NOCC(=O)OC(c2ccccc2)c2ccccc2)C(=O)NC2C(=O)N3CC(Cl)(C(=O)O)CS[C@H]23)cs1 |
| InChI | InChI=1S/C27H24ClN5O7S2/c28-27(25(37)38)13-33-23(36)20(24(33)42-14-27)31-22(35)19(17-12-41-26(29)30-17)32-39-11-18(34)40-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,12,20-21,24H,11,13-14H2,(H2,29,30)(H,31,35)(H,37,38)/t20?,24-,27?/m1/s1 |
| InChIKey | CPFLLQDZANIERC-CLBCXVIASA-N |
| XLogP | 2.24 |
| TPSA | 173.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.10 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|