C14H15ClN5NaO5S2 — CID 173389606
sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173389606) has the molecular formula C14H15ClN5NaO5S2 and a molecular weight of 455.88 g/mol. Its IUPAC name is sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173389606 |
| Molecular Formula | C14H15ClN5NaO5S2 |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CCON=C(C(=O)NC1C(=O)N2CC(Cl)(C(=O)[O-])CS[C@H]12)c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C14H16ClN5O5S2.Na/c1-2-25-19-7(6-3-26-13(16)17-6)9(21)18-8-10(22)20-4-14(15,12(23)24)5-27-11(8)20;/h3,8,11H,2,4-5H2,1H3,(H2,16,17)(H,18,21)(H,23,24);/q;+1/p-1/t8?,11-,14?;/m1./s1 |
| InChIKey | KSEINJKCBPJWEX-YRPWNRKYSA-M |
| XLogP | -4.40 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|