C19H25N10O5S3+ — CID 173335687
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-8-oxo-3-[(1,4,6-triaminopyrimidin-1-ium-2-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173335687) has the molecular formula C19H25N10O5S3+ and a molecular weight of 569.68 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-8-oxo-3-[(1,4,6-triaminopyrimidin-1-ium-2-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-8-oxo-3-[(1,4,6-triaminopyrimidin-1-ium-2-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173335687 |
| Molecular Formula | C19H25N10O5S3+ |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-8-oxo-3-[(1,4,6-triaminopyrimidin-1-ium-2-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CCON=C(C(=O)NC1C(=O)N2CC(CSc3nc(N)cc(N)[n+]3N)(C(=O)O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C19H24N10O5S3/c1-2-34-27-11(8-4-35-17(22)24-8)13(30)26-12-14(31)28-5-19(16(32)33,6-36-15(12)28)7-37-18-25-9(20)3-10(21)29(18)23/h3-4,12,15H,2,5-7,23H2,1H3,(H7,20,21,22,24,26,30,32,33)/p+1/t12?,15-,19?/m1/s1 |
| InChIKey | YKLOSIVGYGHMOL-WXYZLBAPSA-O |
| XLogP | -1.71 |
| TPSA | 242.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|