C19H17ClN6O7S2 — CID 173389553
(4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173389553) has the molecular formula C19H17ClN6O7S2 and a molecular weight of 540.97 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173389553 |
| Molecular Formula | C19H17ClN6O7S2 |
| Molecular Weight | 540.97 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | Nc1nc(C(=NO)C(=O)NC2C(=O)N3CC(Cl)(C(=O)OCc4ccc([N+](=O)[O-])cc4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C19H17ClN6O7S2/c20-19(17(29)33-5-9-1-3-10(4-2-9)26(31)32)7-25-15(28)13(16(25)35-8-19)23-14(27)12(24-30)11-6-34-18(21)22-11/h1-4,6,13,16,30H,5,7-8H2,(H2,21,22)(H,23,27)/t13?,16-,19?/m1/s1 |
| InChIKey | YERZBJJZERXCGQ-ZHTDJMBKSA-N |
| XLogP | 0.93 |
| TPSA | 190.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.97 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|