C18H19N6O5S2+ — CID 173428182
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173428182) has the molecular formula C18H19N6O5S2+ and a molecular weight of 463.52 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173428182 |
| Molecular Formula | C18H19N6O5S2+ |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | Nc1nc(C(=NO)C(=O)NC2C(=O)N3CC(C[n+]4ccccc4)(C(=O)O)CS[C@H]23)cs1 |
| InChI | InChI=1S/C18H18N6O5S2/c19-17-20-10(6-30-17)11(22-29)13(25)21-12-14(26)24-8-18(16(27)28,9-31-15(12)24)7-23-4-2-1-3-5-23/h1-6,12,15H,7-9H2,(H4-,19,20,21,25,27,28,29)/p+1/t12?,15-,18?/m1/s1 |
| InChIKey | BGVVMKUPTPKOKZ-HBSPSFQMSA-O |
| XLogP | -0.64 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|