C21H29N5O8S2 — CID 173425823
1-(2,2-dimethylpropanoyloxy)ethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173425823) has the molecular formula C21H29N5O8S2 and a molecular weight of 543.62 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyloxy)ethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | 1-(2,2-dimethylpropanoyloxy)ethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173425823 |
| Molecular Formula | C21H29N5O8S2 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 1-(2,2-dimethylpropanoyloxy)ethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | COCC1(C(=O)OC(C)OC(=O)C(C)(C)C)CS[C@@H]2C(NC(=O)C(=NO)c3csc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C21H29N5O8S2/c1-10(33-17(29)20(2,3)4)34-18(30)21(8-32-5)7-26-15(28)13(16(26)36-9-21)24-14(27)12(25-31)11-6-35-19(22)23-11/h6,10,13,16,31H,7-9H2,1-5H3,(H2,22,23)(H,24,27)/t10?,13?,16-,21?/m1/s1 |
| InChIKey | HTZPSESXNGEJMQ-WGKQSZNFSA-N |
| XLogP | 0.41 |
| TPSA | 182.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|