C23H29N5O9S2 — CID 173393153
2,2-dimethylpropanoyloxymethyl (6R)-3-(3-acetyloxyprop-1-enyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173393153) has the molecular formula C23H29N5O9S2 and a molecular weight of 583.65 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (6R)-3-(3-acetyloxyprop-1-enyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (6R)-3-(3-acetyloxyprop-1-enyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173393153 |
| Molecular Formula | C23H29N5O9S2 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (6R)-3-(3-acetyloxyprop-1-enyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CC(=O)OCC=CC1(C(=O)OCOC(=O)C(C)(C)C)CS[C@@H]2C(NC(=O)C(=NO)c3csc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C23H29N5O9S2/c1-12(29)35-7-5-6-23(20(33)37-11-36-19(32)22(2,3)4)9-28-17(31)15(18(28)39-10-23)26-16(30)14(27-34)13-8-38-21(24)25-13/h5-6,8,15,18,34H,7,9-11H2,1-4H3,(H2,24,25)(H,26,30)/t15?,18-,23?/m1/s1 |
| InChIKey | HOYQUZRJIGEEFI-AWVSAENJSA-N |
| XLogP | 0.50 |
| TPSA | 199.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|