C23H30N6O9S2 — CID 173339416
2-ethylbutanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(3-carbamoyloxyprop-1-enyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173339416) has the molecular formula C23H30N6O9S2 and a molecular weight of 598.66 g/mol. Its IUPAC name is 2-ethylbutanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(3-carbamoyloxyprop-1-enyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | 2-ethylbutanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(3-carbamoyloxyprop-1-enyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173339416 |
| Molecular Formula | C23H30N6O9S2 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 2-ethylbutanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(3-carbamoyloxyprop-1-enyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CCC(CC)C(=O)OCOC(=O)C1(C=CCOC(N)=O)CS[C@@H]2C(NC(=O)C(=NO)c3csc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C23H30N6O9S2/c1-3-12(4-2)19(32)37-11-38-20(33)23(6-5-7-36-22(25)34)9-29-17(31)15(18(29)40-10-23)27-16(30)14(28-35)13-8-39-21(24)26-13/h5-6,8,12,15,18,35H,3-4,7,9-11H2,1-2H3,(H2,24,26)(H2,25,34)(H,27,30)/t15?,18-,23?/m1/s1 |
| InChIKey | PUHYYJXYVPZDSV-AWVSAENJSA-N |
| XLogP | 0.42 |
| TPSA | 225.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|