C16H14N7NaO5S3 — CID 173375847
sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[2-(thiadiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173375847) has the molecular formula C16H14N7NaO5S3 and a molecular weight of 503.52 g/mol. Its IUPAC name is sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[2-(thiadiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[2-(thiadiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173375847 |
| Molecular Formula | C16H14N7NaO5S3 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-[2-(thiadiazol-4-yl)ethenyl]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | Nc1nc(C(=NO)C(=O)NC2C(=O)N3CC(C=Cc4csnn4)(C(=O)[O-])CS[C@H]23)cs1.[Na+] |
| InChI | InChI=1S/C16H15N7O5S3.Na/c17-15-18-8(4-29-15)9(21-28)11(24)19-10-12(25)23-5-16(14(26)27,6-30-13(10)23)2-1-7-3-31-22-20-7;/h1-4,10,13,28H,5-6H2,(H2,17,18)(H,19,24)(H,26,27);/q;+1/p-1/t10?,13-,16?;/m1./s1 |
| InChIKey | UOPBFJXWFYVZJJ-GCXHBBRWSA-M |
| XLogP | -4.39 |
| TPSA | 186.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|