C18H19N5O9S2 — CID 173359321
2-[(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carbonyl]oxyacetic acid (PubChem CID 173359321) has the molecular formula C18H19N5O9S2 and a molecular weight of 513.51 g/mol. Its IUPAC name is 2-[(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carbonyl]oxyacetic acid.
| Compound Name | 2-[(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carbonyl]oxyacetic acid |
|---|---|
| PubChem CID | 173359321 |
| Molecular Formula | C18H19N5O9S2 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 2-[(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carbonyl]oxyacetic acid |
| SMILES | C=CC1(C(=O)OCC(=O)O)CS[C@@H]2C(NC(=O)C(=NOCC(=O)O)c3csc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C18H19N5O9S2/c1-2-18(16(30)31-3-9(24)25)6-23-14(29)12(15(23)34-7-18)21-13(28)11(22-32-4-10(26)27)8-5-33-17(19)20-8/h2,5,12,15H,1,3-4,6-7H2,(H2,19,20)(H,21,28)(H,24,25)(H,26,27)/t12?,15-,18?/m1/s1 |
| InChIKey | JTEWFMJBZGXQSY-HBSPSFQMSA-N |
| XLogP | -1.27 |
| TPSA | 210.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|