C23H21N6NaO9S2 — CID 173359338
sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]iminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173359338) has the molecular formula C23H21N6NaO9S2 and a molecular weight of 612.58 g/mol. Its IUPAC name is sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]iminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]iminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173359338 |
| Molecular Formula | C23H21N6NaO9S2 |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.07 |
| IUPAC Name | sodium (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]iminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | C=CC1(C(=O)[O-])CS[C@@H]2C(NC(=O)C(=NOCC(=O)OCc3ccc([N+](=O)[O-])cc3)c3csc(N)n3)C(=O)N2C1.[Na+] |
| InChI | InChI=1S/C23H22N6O9S2.Na/c1-2-23(21(33)34)10-28-19(32)17(20(28)40-11-23)26-18(31)16(14-9-39-22(24)25-14)27-38-8-15(30)37-7-12-3-5-13(6-4-12)29(35)36;/h2-6,9,17,20H,1,7-8,10-11H2,(H2,24,25)(H,26,31)(H,33,34);/q;+1/p-1/t17?,20-,23?;/m1./s1 |
| InChIKey | KDICOOYOJRCNEV-UESXFTGDSA-M |
| XLogP | -3.58 |
| TPSA | 219.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|