C19H19N7O9S — CID 13489015
(4-nitrophenyl)methyl 2-[(2S,3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-carbamoyl-4-oxoazetidin-1-yl]oxyacetate (PubChem CID 13489015) has the molecular formula C19H19N7O9S and a molecular weight of 521.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2S,3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-carbamoyl-4-oxoazetidin-1-yl]oxyacetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2S,3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-carbamoyl-4-oxoazetidin-1-yl]oxyacetate |
|---|---|
| PubChem CID | 13489015 |
| Molecular Formula | C19H19N7O9S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2S,3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-carbamoyl-4-oxoazetidin-1-yl]oxyacetate |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N(OCC(=O)OCc2ccc([N+](=O)[O-])cc2)[C@@H]1C(N)=O)c1csc(N)n1 |
| InChI | InChI=1S/C19H19N7O9S/c1-33-24-13(11-8-36-19(21)22-11)17(29)23-14-15(16(20)28)25(18(14)30)35-7-12(27)34-6-9-2-4-10(5-3-9)26(31)32/h2-5,8,14-15H,6-7H2,1H3,(H2,20,28)(H2,21,22)(H,23,29)/b24-13-/t14-,15-/m0/s1 |
| InChIKey | UJKBQSJUJHOYQT-HEYQCYJQSA-N |
| XLogP | -1.16 |
| TPSA | 231.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|