C18H22N4O9 — CID 70417354
(4-nitrophenyl)methyl 2-[(2R,3S)-2-carbamoyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]oxyacetate (PubChem CID 70417354) has the molecular formula C18H22N4O9 and a molecular weight of 438.39 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R,3S)-2-carbamoyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]oxyacetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R,3S)-2-carbamoyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]oxyacetate |
|---|---|
| PubChem CID | 70417354 |
| Molecular Formula | C18H22N4O9 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R,3S)-2-carbamoyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]oxyacetate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C(=O)N(OCC(=O)OCc2ccc([N+](=O)[O-])cc2)[C@H]1C(N)=O |
| InChI | InChI=1S/C18H22N4O9/c1-18(2,3)31-17(26)20-13-14(15(19)24)21(16(13)25)30-9-12(23)29-8-10-4-6-11(7-5-10)22(27)28/h4-7,13-14H,8-9H2,1-3H3,(H2,19,24)(H,20,26)/t13-,14+/m0/s1 |
| InChIKey | OVXXAXWWIVOMGT-UONOGXRCSA-N |
| XLogP | 0.16 |
| TPSA | 180.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|