C18H23N3O11 — CID 154477263
(2R)-4-amino-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]-4-oxobutanoic acid (PubChem CID 154477263) has the molecular formula C18H23N3O11 and a molecular weight of 457.39 g/mol. Its IUPAC name is (2R)-4-amino-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 154477263 |
| Molecular Formula | C18H23N3O11 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (2R)-4-amino-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@](OCC(=O)OCc1ccc([N+](=O)[O-])cc1)(C(=O)O)C(O)C(N)=O |
| InChI | InChI=1S/C18H23N3O11/c1-17(2,3)32-16(27)20-18(15(25)26,13(23)14(19)24)31-9-12(22)30-8-10-4-6-11(7-5-10)21(28)29/h4-7,13,23H,8-9H2,1-3H3,(H2,19,24)(H,20,27)(H,25,26)/t13?,18-/m1/s1 |
| InChIKey | JXNZKHRGJHUFIW-PQJIZZRHSA-N |
| XLogP | -0.19 |
| TPSA | 217.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|