C17H25N5O7 — CID 139647391
(4-nitrophenyl)methyl N-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoylamino]propyl]carbamate (PubChem CID 139647391) has the molecular formula C17H25N5O7 and a molecular weight of 411.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoylamino]propyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoylamino]propyl]carbamate |
|---|---|
| PubChem CID | 139647391 |
| Molecular Formula | C17H25N5O7 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (4-nitrophenyl)methyl N-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)NCCCNC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H25N5O7/c1-17(2,3)29-16(25)21-20-14(23)18-9-4-10-19-15(24)28-11-12-5-7-13(8-6-12)22(26)27/h5-8H,4,9-11H2,1-3H3,(H,19,24)(H,21,25)(H2,18,20,23) |
| InChIKey | MSEKHUSBMVNLEC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|