C14H21N2O8P — CID 66606031
(4-nitrophenyl)methyl N-(6-phosphonooxyhexyl)carbamate (PubChem CID 66606031) has the molecular formula C14H21N2O8P and a molecular weight of 376.30 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-(6-phosphonooxyhexyl)carbamate.
| Compound Name | (4-nitrophenyl)methyl N-(6-phosphonooxyhexyl)carbamate |
|---|---|
| PubChem CID | 66606031 |
| Molecular Formula | C14H21N2O8P |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (4-nitrophenyl)methyl N-(6-phosphonooxyhexyl)carbamate |
| SMILES | O=C(NCCCCCCOP(=O)(O)O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H21N2O8P/c17-14(15-9-3-1-2-4-10-24-25(20,21)22)23-11-12-5-7-13(8-6-12)16(18)19/h5-8H,1-4,9-11H2,(H,15,17)(H2,20,21,22) |
| InChIKey | NVCNEBJLDGDPKP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|