C13H16N2O7 — CID 139627176
(2S)-2-hydroxy-5-[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid (PubChem CID 139627176) has the molecular formula C13H16N2O7 and a molecular weight of 312.28 g/mol. Its IUPAC name is (2S)-2-hydroxy-5-[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-2-hydroxy-5-[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 139627176 |
| Molecular Formula | C13H16N2O7 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (2S)-2-hydroxy-5-[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid |
| SMILES | O=C(NCCC[C@H](O)C(=O)O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H16N2O7/c16-11(12(17)18)2-1-7-14-13(19)22-8-9-3-5-10(6-4-9)15(20)21/h3-6,11,16H,1-2,7-8H2,(H,14,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | CAGGRRKAOFRINE-NSHDSACASA-N |
| XLogP | 1.05 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|