C22H22F2N4O10 — CID 71449794
2-(difluoromethyl)-2,5-bis[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid (PubChem CID 71449794) has the molecular formula C22H22F2N4O10 and a molecular weight of 540.43 g/mol. Its IUPAC name is 2-(difluoromethyl)-2,5-bis[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid.
| Compound Name | 2-(difluoromethyl)-2,5-bis[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 71449794 |
| Molecular Formula | C22H22F2N4O10 |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2-(difluoromethyl)-2,5-bis[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid |
| SMILES | O=C(NCCCC(NC(=O)OCc1ccc([N+](=O)[O-])cc1)(C(=O)O)C(F)F)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H22F2N4O10/c23-18(24)22(19(29)30,26-21(32)38-13-15-4-8-17(9-5-15)28(35)36)10-1-11-25-20(31)37-12-14-2-6-16(7-3-14)27(33)34/h2-9,18H,1,10-13H2,(H,25,31)(H,26,32)(H,29,30) |
| InChIKey | YHENFYACUSZRQO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 200.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|