C15H17N3O6S — CID 88735376
(Z)-5-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylamino]-5-oxopent-3-enethioic S-acid (PubChem CID 88735376) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is (Z)-5-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylamino]-5-oxopent-3-enethioic S-acid.
| Compound Name | (Z)-5-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylamino]-5-oxopent-3-enethioic S-acid |
|---|---|
| PubChem CID | 88735376 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (Z)-5-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylamino]-5-oxopent-3-enethioic S-acid |
| SMILES | O=C(S)C/C=C\C(=O)NCCNC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17N3O6S/c19-13(2-1-3-14(20)25)16-8-9-17-15(21)24-10-11-4-6-12(7-5-11)18(22)23/h1-2,4-7H,3,8-10H2,(H,16,19)(H,17,21)(H,20,25)/b2-1- |
| InChIKey | CRXFCXHMUDLKQK-UPHRSURJSA-N |
| XLogP | 1.34 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|