C13H14N2O5S — CID 88722537
S-[(E)-1-[(4-nitrophenyl)methoxycarbonylamino]but-2-en-2-yl] methanethioate (PubChem CID 88722537) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is S-[(E)-1-[(4-nitrophenyl)methoxycarbonylamino]but-2-en-2-yl] methanethioate.
| Compound Name | S-[(E)-1-[(4-nitrophenyl)methoxycarbonylamino]but-2-en-2-yl] methanethioate |
|---|---|
| PubChem CID | 88722537 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | S-[(E)-1-[(4-nitrophenyl)methoxycarbonylamino]but-2-en-2-yl] methanethioate |
| SMILES | C/C=C(\CNC(=O)OCc1ccc([N+](=O)[O-])cc1)SC=O |
| InChI | InChI=1S/C13H14N2O5S/c1-2-12(21-9-16)7-14-13(17)20-8-10-3-5-11(6-4-10)15(18)19/h2-6,9H,7-8H2,1H3,(H,14,17)/b12-2+ |
| InChIKey | KKQBFXVFQIPDIM-SWGQDTFXSA-N |
| XLogP | 2.65 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|