About (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate
(4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate (PubChem CID 21150662) has the molecular formula C14H11ClN2O4S2
and a molecular weight of 370.84 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate |
| PubChem CID | 21150662 |
| Molecular Formula | C14H11ClN2O4S2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(SSCl)cc1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H11ClN2O4S2/c15-23-22-13-7-3-11(4-8-13)16-14(18)21-9-10-1-5-12(6-2-10)17(19)20/h1-8H,9H2,(H,16,18) |
| InChIKey | WVQMFDJTTXQDCV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate?
The IUPAC name of (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate (CID 21150662) is (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate.
What is the SMILES notation for (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate?
The canonical SMILES for (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate is O=C(Nc1ccc(SSCl)cc1)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate?
The InChIKey is WVQMFDJTTXQDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2O4S2/c15-23-22-13-7-3-11(4-8-13)16-14(18)21-9-10-1-5-12(6-2-10)17(19)20/h1-8H,9H2,(H,16,18).
What are the key properties of (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate?
(4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate has a molecular weight of 370.84 g/mol, XLogP of 5.24, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl N-[4-(chlorodisulfanyl)phenyl]carbamate is sourced from PubChem (CID 21150662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).