About (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate
(4-nitrophenyl)methyl 3-chloro-3-oxopropanoate (PubChem CID 71324193) has the molecular formula C10H8ClNO5
and a molecular weight of 257.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate |
| PubChem CID | 71324193 |
| Molecular Formula | C10H8ClNO5 |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate |
| SMILES | O=C(Cl)CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H8ClNO5/c11-9(13)5-10(14)17-6-7-1-3-8(4-2-7)12(15)16/h1-4H,5-6H2 |
| InChIKey | DJYGRKHBBBKTOQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate?
The IUPAC name of (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate (CID 71324193) is (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate.
What is the SMILES notation for (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate?
The canonical SMILES for (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate is O=C(Cl)CC(=O)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate?
The InChIKey is DJYGRKHBBBKTOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO5/c11-9(13)5-10(14)17-6-7-1-3-8(4-2-7)12(15)16/h1-4H,5-6H2.
What are the key properties of (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate?
(4-nitrophenyl)methyl 3-chloro-3-oxopropanoate has a molecular weight of 257.63 g/mol, XLogP of 1.79, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl 3-chloro-3-oxopropanoate is sourced from PubChem (CID 71324193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).