About 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate
4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate (PubChem CID 161044982) has the molecular formula C27H23NO11
and a molecular weight of 537.48 g/mol. Its IUPAC name is 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate.
Molecular Properties
| Compound Name | 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate |
| PubChem CID | 161044982 |
| Molecular Formula | C27H23NO11 |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)CC(=O)OCc2ccc([N+](=O)[O-])cc2)cc1.COC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H15NO7.C9H8O4/c1-25-18(22)14-6-4-13(5-7-14)16(20)10-17(21)26-11-12-2-8-15(9-3-12)19(23)24;1-13-9(12)7-4-2-6(3-5-7)8(10)11/h2-9H,10-11H2,1H3;2-5H,1H3,(H,10,11) |
| InChIKey | UBJQQBZYNWMUNQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 176.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate?
The IUPAC name of 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate (CID 161044982) is 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate.
What is the SMILES notation for 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate?
The canonical SMILES for 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate is COC(=O)c1ccc(C(=O)CC(=O)OCc2ccc([N+](=O)[O-])cc2)cc1.COC(=O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate?
The InChIKey is UBJQQBZYNWMUNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO7.C9H8O4/c1-25-18(22)14-6-4-13(5-7-14)16(20)10-17(21)26-11-12-2-8-15(9-3-12)19(23)24;1-13-9(12)7-4-2-6(3-5-7)8(10)11/h2-9H,10-11H2,1H3;2-5H,1H3,(H,10,11).
What are the key properties of 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate?
4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate has a molecular weight of 537.48 g/mol, XLogP of 3.87, 9 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycarbonylbenzoic acid;methyl 4-[3-[(4-nitrophenyl)methoxy]-3-oxopropanoyl]benzoate is sourced from PubChem (CID 161044982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).