C11H8Cl3NO6 — CID 70634202
1-O-[(4-nitrophenyl)methyl] 2-O-(2,2,2-trichloroethyl) oxalate (PubChem CID 70634202) has the molecular formula C11H8Cl3NO6 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1-O-[(4-nitrophenyl)methyl] 2-O-(2,2,2-trichloroethyl) oxalate.
| Compound Name | 1-O-[(4-nitrophenyl)methyl] 2-O-(2,2,2-trichloroethyl) oxalate |
|---|---|
| PubChem CID | 70634202 |
| Molecular Formula | C11H8Cl3NO6 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 1-O-[(4-nitrophenyl)methyl] 2-O-(2,2,2-trichloroethyl) oxalate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H8Cl3NO6/c12-11(13,14)6-21-10(17)9(16)20-5-7-1-3-8(4-2-7)15(18)19/h1-4H,5-6H2 |
| InChIKey | FYEOVHDLUUMPQD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|