C9H9NO5S3 — CID 174801367
carbonotrithioic acid;(4-nitrophenyl)methyl hydrogen carbonate (PubChem CID 174801367) has the molecular formula C9H9NO5S3 and a molecular weight of 307.37 g/mol. Its IUPAC name is carbonotrithioic acid;(4-nitrophenyl)methyl hydrogen carbonate.
| Compound Name | carbonotrithioic acid;(4-nitrophenyl)methyl hydrogen carbonate |
|---|---|
| PubChem CID | 174801367 |
| Molecular Formula | C9H9NO5S3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | carbonotrithioic acid;(4-nitrophenyl)methyl hydrogen carbonate |
| SMILES | O=C(O)OCc1ccc([N+](=O)[O-])cc1.S=C(S)S |
| InChI | InChI=1S/C8H7NO5.CH2S3/c10-8(11)14-5-6-1-3-7(4-2-6)9(12)13;2-1(3)4/h1-4H,5H2,(H,10,11);(H2,2,3,4) |
| InChIKey | GPFOSVMIRPBROE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|