C15H17NO7 — CID 21253089
(4-nitrophenyl)methyl 4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutanoate (PubChem CID 21253089) has the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutanoate.
| Compound Name | (4-nitrophenyl)methyl 4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 21253089 |
| Molecular Formula | C15H17NO7 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (4-nitrophenyl)methyl 4-(2-methyl-1,3-dioxolan-2-yl)-3-oxobutanoate |
| SMILES | CC1(CC(=O)CC(=O)OCc2ccc([N+](=O)[O-])cc2)OCCO1 |
| InChI | InChI=1S/C15H17NO7/c1-15(22-6-7-23-15)9-13(17)8-14(18)21-10-11-2-4-12(5-3-11)16(19)20/h2-5H,6-10H2,1H3 |
| InChIKey | WTAFDTOPBLZBFY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|