C23H22N3O9P — CID 14250016
benzyl N-[bis[(4-nitrophenyl)methoxy]phosphorylmethyl]carbamate (PubChem CID 14250016) has the molecular formula C23H22N3O9P and a molecular weight of 515.42 g/mol. Its IUPAC name is benzyl N-[bis[(4-nitrophenyl)methoxy]phosphorylmethyl]carbamate.
| Compound Name | benzyl N-[bis[(4-nitrophenyl)methoxy]phosphorylmethyl]carbamate |
|---|---|
| PubChem CID | 14250016 |
| Molecular Formula | C23H22N3O9P |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | benzyl N-[bis[(4-nitrophenyl)methoxy]phosphorylmethyl]carbamate |
| SMILES | O=C(NCP(=O)(OCc1ccc([N+](=O)[O-])cc1)OCc1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H22N3O9P/c27-23(33-14-18-4-2-1-3-5-18)24-17-36(32,34-15-19-6-10-21(11-7-19)25(28)29)35-16-20-8-12-22(13-9-20)26(30)31/h1-13H,14-17H2,(H,24,27) |
| InChIKey | GRQNRKOKLSGERE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|