C32H48N2O13 — CID 170563898
benzyl N-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 170563898) has the molecular formula C32H48N2O13 and a molecular weight of 668.74 g/mol. Its IUPAC name is benzyl N-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170563898 |
| Molecular Formula | C32H48N2O13 |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | benzyl N-[2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | O=C(NCCOCCOCCOCCOCCOCCOCCOCCOCCOc1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H48N2O13/c35-32(47-28-29-4-2-1-3-5-29)33-10-11-38-12-13-39-14-15-40-16-17-41-18-19-42-20-21-43-22-23-44-24-25-45-26-27-46-31-8-6-30(7-9-31)34(36)37/h1-9H,10-28H2,(H,33,35) |
| InChIKey | CMLVTKCLRLMNRD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 164.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|