C20H23BrClNO5 — CID 142581171
benzyl N-[2-[2-[2-(3-bromo-5-chlorophenoxy)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 142581171) has the molecular formula C20H23BrClNO5 and a molecular weight of 472.76 g/mol. Its IUPAC name is benzyl N-[2-[2-[2-(3-bromo-5-chlorophenoxy)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2-[2-(3-bromo-5-chlorophenoxy)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 142581171 |
| Molecular Formula | C20H23BrClNO5 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | benzyl N-[2-[2-[2-(3-bromo-5-chlorophenoxy)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | O=C(NCCOCCOCCOc1cc(Cl)cc(Br)c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H23BrClNO5/c21-17-12-18(22)14-19(13-17)27-11-10-26-9-8-25-7-6-23-20(24)28-15-16-4-2-1-3-5-16/h1-5,12-14H,6-11,15H2,(H,23,24) |
| InChIKey | LISVQOXXTWRLBC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|