C17H16BrNO5 — CID 167739160
2-[3-bromo-5-(phenylmethoxycarbonylaminomethyl)phenoxy]acetic acid (PubChem CID 167739160) has the molecular formula C17H16BrNO5 and a molecular weight of 394.22 g/mol. Its IUPAC name is 2-[3-bromo-5-(phenylmethoxycarbonylaminomethyl)phenoxy]acetic acid.
| Compound Name | 2-[3-bromo-5-(phenylmethoxycarbonylaminomethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 167739160 |
| Molecular Formula | C17H16BrNO5 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-[3-bromo-5-(phenylmethoxycarbonylaminomethyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1cc(Br)cc(CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H16BrNO5/c18-14-6-13(7-15(8-14)23-11-16(20)21)9-19-17(22)24-10-12-4-2-1-3-5-12/h1-8H,9-11H2,(H,19,22)(H,20,21) |
| InChIKey | WEQLWBKJUKRIPO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |