C20H24N4O6 — CID 69459510
benzyl N-(2-amino-2-oxoethyl)carbamate (PubChem CID 69459510) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is benzyl N-(2-amino-2-oxoethyl)carbamate.
| Compound Name | benzyl N-(2-amino-2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 69459510 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | benzyl N-(2-amino-2-oxoethyl)carbamate |
| SMILES | NC(=O)CNC(=O)OCc1ccccc1.NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/2C10H12N2O3/c2*11-9(13)6-12-10(14)15-7-8-4-2-1-3-5-8/h2*1-5H,6-7H2,(H2,11,13)(H,12,14) |
| InChIKey | SCHQIWYDSVICLI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |