C11H11NO4 — CID 105477006
benzyl N-(2,3-dioxopropyl)carbamate (PubChem CID 105477006) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is benzyl N-(2,3-dioxopropyl)carbamate.
| Compound Name | benzyl N-(2,3-dioxopropyl)carbamate |
|---|---|
| PubChem CID | 105477006 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | benzyl N-(2,3-dioxopropyl)carbamate |
| SMILES | O=CC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H11NO4/c13-7-10(14)6-12-11(15)16-8-9-4-2-1-3-5-9/h1-5,7H,6,8H2,(H,12,15) |
| InChIKey | PLFHQLABXYTQDB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|