C14H22N2O3 — CID 169191565
benzyl N-(2-amino-2-oxoethyl)carbamate;2-methylpropane (PubChem CID 169191565) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is benzyl N-(2-amino-2-oxoethyl)carbamate;2-methylpropane.
| Compound Name | benzyl N-(2-amino-2-oxoethyl)carbamate;2-methylpropane |
|---|---|
| PubChem CID | 169191565 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | benzyl N-(2-amino-2-oxoethyl)carbamate;2-methylpropane |
| SMILES | CC(C)C.NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H12N2O3.C4H10/c11-9(13)6-12-10(14)15-7-8-4-2-1-3-5-8;1-4(2)3/h1-5H,6-7H2,(H2,11,13)(H,12,14);4H,1-3H3 |
| InChIKey | UADLXGDDNFUWEG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |