C13H18N4O4 — CID 5479014
benzyl N-[2-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate (PubChem CID 5479014) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 5479014 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | benzyl N-[2-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate |
| SMILES | C[C@H](NC(=O)CNC(=O)OCc1ccccc1)C(=O)NN |
| InChI | InChI=1S/C13H18N4O4/c1-9(12(19)17-14)16-11(18)7-15-13(20)21-8-10-5-3-2-4-6-10/h2-6,9H,7-8,14H2,1H3,(H,15,20)(H,16,18)(H,17,19)/t9-/m0/s1 |
| InChIKey | RUFWMZPCICASLB-VIFPVBQESA-N |
| XLogP | -0.59 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|