C22H26N2O4 — CID 167053629
benzyl N-[2-[[(2S)-4-methyl-3-oxo-1-phenylpentan-2-yl]amino]-2-oxoethyl]carbamate (PubChem CID 167053629) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-4-methyl-3-oxo-1-phenylpentan-2-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S)-4-methyl-3-oxo-1-phenylpentan-2-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 167053629 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | benzyl N-[2-[[(2S)-4-methyl-3-oxo-1-phenylpentan-2-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)C(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-16(2)21(26)19(13-17-9-5-3-6-10-17)24-20(25)14-23-22(27)28-15-18-11-7-4-8-12-18/h3-12,16,19H,13-15H2,1-2H3,(H,23,27)(H,24,25)/t19-/m0/s1 |
| InChIKey | XCTWALNJKTWRQA-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |