C21H24N4O5 — CID 12919697
benzyl N-[2-[[(2S)-1-(2-acetylhydrazinyl)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]carbamate (PubChem CID 12919697) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-1-(2-acetylhydrazinyl)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S)-1-(2-acetylhydrazinyl)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 12919697 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | benzyl N-[2-[[(2S)-1-(2-acetylhydrazinyl)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(=O)NNC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H24N4O5/c1-15(26)24-25-20(28)18(12-16-8-4-2-5-9-16)23-19(27)13-22-21(29)30-14-17-10-6-3-7-11-17/h2-11,18H,12-14H2,1H3,(H,22,29)(H,23,27)(H,24,26)(H,25,28)/t18-/m0/s1 |
| InChIKey | LYHIFNOCXDRKHD-SFHVURJKSA-N |
| XLogP | 0.81 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|