C26H31N5O9 — CID 170314630
2-[[[2-[[3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoyl]amino]acetyl]amino]methoxy]acetic acid (PubChem CID 170314630) has the molecular formula C26H31N5O9 and a molecular weight of 557.56 g/mol. Its IUPAC name is 2-[[[2-[[3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoyl]amino]acetyl]amino]methoxy]acetic acid.
| Compound Name | 2-[[[2-[[3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoyl]amino]acetyl]amino]methoxy]acetic acid |
|---|---|
| PubChem CID | 170314630 |
| Molecular Formula | C26H31N5O9 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 2-[[[2-[[3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoyl]amino]acetyl]amino]methoxy]acetic acid |
| SMILES | O=C(O)COCNC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H31N5O9/c32-21(13-29-26(38)40-15-19-9-5-2-6-10-19)27-14-23(34)31-20(11-18-7-3-1-4-8-18)25(37)28-12-22(33)30-17-39-16-24(35)36/h1-10,20H,11-17H2,(H,27,32)(H,28,37)(H,29,38)(H,30,33)(H,31,34)(H,35,36) |
| InChIKey | UVTAPWRWQPHIPR-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 201.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|