C18H26N6O6 — CID 163708068
(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-[2-[(2-amino-2-oxoethoxy)methylamino]-2-oxoethyl]-3-phenylpropanamide (PubChem CID 163708068) has the molecular formula C18H26N6O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-[2-[(2-amino-2-oxoethoxy)methylamino]-2-oxoethyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-[2-[(2-amino-2-oxoethoxy)methylamino]-2-oxoethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 163708068 |
| Molecular Formula | C18H26N6O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-[2-[(2-amino-2-oxoethoxy)methylamino]-2-oxoethyl]-3-phenylpropanamide |
| SMILES | NCC(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)NCOCC(N)=O |
| InChI | InChI=1S/C18H26N6O6/c19-7-15(26)21-9-17(28)24-13(6-12-4-2-1-3-5-12)18(29)22-8-16(27)23-11-30-10-14(20)25/h1-5,13H,6-11,19H2,(H2,20,25)(H,21,26)(H,22,29)(H,23,27)(H,24,28)/t13-/m0/s1 |
| InChIKey | KGULLOSGWUVDMJ-ZDUSSCGKSA-N |
| XLogP | -3.52 |
| TPSA | 194.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|