C20H30N4O5 — CID 167240572
2-[[2-(methylamino)acetyl]amino]-N-[2-[(3-methyl-2-oxobutoxy)methylamino]-2-oxoethyl]-3-phenylpropanamide (PubChem CID 167240572) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[[2-(methylamino)acetyl]amino]-N-[2-[(3-methyl-2-oxobutoxy)methylamino]-2-oxoethyl]-3-phenylpropanamide.
| Compound Name | 2-[[2-(methylamino)acetyl]amino]-N-[2-[(3-methyl-2-oxobutoxy)methylamino]-2-oxoethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 167240572 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-[[2-(methylamino)acetyl]amino]-N-[2-[(3-methyl-2-oxobutoxy)methylamino]-2-oxoethyl]-3-phenylpropanamide |
| SMILES | CNCC(=O)NC(Cc1ccccc1)C(=O)NCC(=O)NCOCC(=O)C(C)C |
| InChI | InChI=1S/C20H30N4O5/c1-14(2)17(25)12-29-13-23-18(26)11-22-20(28)16(24-19(27)10-21-3)9-15-7-5-4-6-8-15/h4-8,14,16,21H,9-13H2,1-3H3,(H,22,28)(H,23,26)(H,24,27) |
| InChIKey | SNVRUZSJKGBVQP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|