C17H22N4O7 — CID 18487764
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]butanedioic acid (PubChem CID 18487764) has the molecular formula C17H22N4O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18487764 |
| Molecular Formula | C17H22N4O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
| SMILES | NCC(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H22N4O7/c18-8-13(22)19-9-14(23)20-11(6-10-4-2-1-3-5-10)16(26)21-12(17(27)28)7-15(24)25/h1-5,11-12H,6-9,18H2,(H,19,22)(H,20,23)(H,21,26)(H,24,25)(H,27,28) |
| InChIKey | RQBGQSNRHZPGPV-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |