C19H29N5O5 — CID 18487770
6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 18487770) has the molecular formula C19H29N5O5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18487770 |
| Molecular Formula | C19H29N5O5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CN)C(=O)O |
| InChI | InChI=1S/C19H29N5O5/c20-9-5-4-8-14(19(28)29)24-18(27)15(10-13-6-2-1-3-7-13)23-17(26)12-22-16(25)11-21/h1-3,6-7,14-15H,4-5,8-12,20-21H2,(H,22,25)(H,23,26)(H,24,27)(H,28,29) |
| InChIKey | PJFPUWYBZYBDIQ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|