C28H41N7O7 — CID 143598411
6-amino-2-[[2-[[(2S)-2-[[2-[[6-amino-2-(prop-2-ynoylamino)hexanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 143598411) has the molecular formula C28H41N7O7 and a molecular weight of 587.68 g/mol. Its IUPAC name is 6-amino-2-[[2-[[(2S)-2-[[2-[[6-amino-2-(prop-2-ynoylamino)hexanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[(2S)-2-[[2-[[6-amino-2-(prop-2-ynoylamino)hexanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 143598411 |
| Molecular Formula | C28H41N7O7 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | 6-amino-2-[[2-[[(2S)-2-[[2-[[6-amino-2-(prop-2-ynoylamino)hexanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | C#CC(=O)NC(CCCCN)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C28H41N7O7/c1-2-23(36)33-20(12-6-8-14-29)26(39)31-18-25(38)35-22(16-19-10-4-3-5-11-19)27(40)32-17-24(37)34-21(28(41)42)13-7-9-15-30/h1,3-5,10-11,20-22H,6-9,12-18,29-30H2,(H,31,39)(H,32,40)(H,33,36)(H,34,37)(H,35,38)(H,41,42)/t20?,21?,22-/m0/s1 |
| InChIKey | KQNUMBDBEAXZEH-HRTMPFAESA-N |
| XLogP | -2.11 |
| TPSA | 234.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|