C27H42ClN7O7 — CID 59710612
(2S)-6-amino-2-[[2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[(2-chloroacetyl)amino]hexanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 59710612) has the molecular formula C27H42ClN7O7 and a molecular weight of 612.13 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[(2-chloroacetyl)amino]hexanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[(2-chloroacetyl)amino]hexanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 59710612 |
| Molecular Formula | C27H42ClN7O7 |
| Molecular Weight | 612.13 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[(2-chloroacetyl)amino]hexanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CCl)C(=O)O |
| InChI | InChI=1S/C27H42ClN7O7/c28-15-22(36)33-19(10-4-6-12-29)25(39)31-17-24(38)35-21(14-18-8-2-1-3-9-18)26(40)32-16-23(37)34-20(27(41)42)11-5-7-13-30/h1-3,8-9,19-21H,4-7,10-17,29-30H2,(H,31,39)(H,32,40)(H,33,36)(H,34,37)(H,35,38)(H,41,42)/t19-,20-,21-/m0/s1 |
| InChIKey | MACJIHCRFGGAHR-ACRUOGEOSA-N |
| XLogP | -1.50 |
| TPSA | 234.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.13 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|