C28H44ClN7O7 — CID 10627746
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2R)-2-amino-3-chloropropanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 10627746) has the molecular formula C28H44ClN7O7 and a molecular weight of 626.16 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2R)-2-amino-3-chloropropanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2R)-2-amino-3-chloropropanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10627746 |
| Molecular Formula | C28H44ClN7O7 |
| Molecular Weight | 626.16 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2R)-2-amino-3-chloropropanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CCl)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C28H44ClN7O7/c1-17(2)12-21(26(40)35-20(28(42)43)10-6-7-11-30)36-27(41)22(13-18-8-4-3-5-9-18)34-24(38)16-32-23(37)15-33-25(39)19(31)14-29/h3-5,8-9,17,19-22H,6-7,10-16,30-31H2,1-2H3,(H,32,37)(H,33,39)(H,34,38)(H,35,40)(H,36,41)(H,42,43)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | OJQOOBSQLYAMSO-CMOCDZPBSA-N |
| XLogP | -1.26 |
| TPSA | 234.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.16 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|