C28H44N6O8 — CID 175891232
(2S)-6-amino-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 175891232) has the molecular formula C28H44N6O8 and a molecular weight of 592.69 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175891232 |
| Molecular Formula | C28H44N6O8 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C28H44N6O8/c1-17(2)14-19(30)25(38)34-22(15-18-8-4-3-5-9-18)26(39)31-16-23(35)32-20(11-12-24(36)37)27(40)33-21(28(41)42)10-6-7-13-29/h3-5,8-9,17,19-22H,6-7,10-16,29-30H2,1-2H3,(H,31,39)(H,32,35)(H,33,40)(H,34,38)(H,36,37)(H,41,42)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | SJKZKOGFNIEDFO-CMOCDZPBSA-N |
| XLogP | -0.75 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|