C31H51N7O7 — CID 10746622
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 10746622) has the molecular formula C31H51N7O7 and a molecular weight of 633.79 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10746622 |
| Molecular Formula | C31H51N7O7 |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.38 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C31H51N7O7/c1-19(2)14-22(33)28(41)35-17-26(39)34-18-27(40)36-25(16-21-10-6-5-7-11-21)30(43)38-24(15-20(3)4)29(42)37-23(31(44)45)12-8-9-13-32/h5-7,10-11,19-20,22-25H,8-9,12-18,32-33H2,1-4H3,(H,34,39)(H,35,41)(H,36,40)(H,37,42)(H,38,43)(H,44,45)/t22-,23-,24-,25-/m0/s1 |
| InChIKey | WRTYNLJDLORMQJ-QORCZRPOSA-N |
| XLogP | -0.45 |
| TPSA | 234.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|