C21H34N4O4 — CID 18222179
2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18222179) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18222179 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H34N4O4/c1-14(2)12-16(23)19(26)24-17(10-6-7-11-22)20(27)25-18(21(28)29)13-15-8-4-3-5-9-15/h3-5,8-9,14,16-18H,6-7,10-13,22-23H2,1-2H3,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | QNTJIDXQHWUBKC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|