C26H42N6O6 — CID 18480988
2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18480988) has the molecular formula C26H42N6O6 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18480988 |
| Molecular Formula | C26H42N6O6 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H42N6O6/c1-16(2)14-20(31-23(34)18(28)11-12-22(29)33)25(36)30-19(10-6-7-13-27)24(35)32-21(26(37)38)15-17-8-4-3-5-9-17/h3-5,8-9,16,18-21H,6-7,10-15,27-28H2,1-2H3,(H2,29,33)(H,30,36)(H,31,34)(H,32,35)(H,37,38) |
| InChIKey | UCFYAZKLRKMAFI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|