C28H46N6O6S — CID 53241486
(2S)-2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 53241486) has the molecular formula C28H46N6O6S and a molecular weight of 594.78 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 53241486 |
| Molecular Formula | C28H46N6O6S |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H46N6O6S/c1-18(2)15-22(27(38)34-23(28(39)40)16-19-9-5-4-6-10-19)32-24(35)17-31-26(37)21(11-7-8-13-29)33-25(36)20(30)12-14-41-3/h4-6,9-10,18,20-23H,7-8,11-17,29-30H2,1-3H3,(H,31,37)(H,32,35)(H,33,36)(H,34,38)(H,39,40)/t20-,21-,22-,23-/m0/s1 |
| InChIKey | FODUUSLCVPJZGX-MLCQCVOFSA-N |
| XLogP | 0.14 |
| TPSA | 205.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|